Orotic acid - CAS 65-86-1

Orotic acid (Cat No.:I004483) is an intermediate compound in the metabolic pathway of pyrimidines, which are essential building blocks of DNA and RNA. OA plays a crucial role in the biosynthesis of pyrimidine nucleotides, such as uridine and cytidine, which are necessary for DNA replication and protein synthesis. Additionally, OA is involved in the regulation of cell growth and proliferation. Its availability and proper metabolism are important for normal cellular functions and the maintenance of nucleotide balance in the body.

Catalog Number: I004483

CAS Number: 65-86-1

PubChem Substance ID:355038397

Molecular Formula: C5H4N2O4

Molecular Weight:156.10

Purity: ≥95%

* For research use only. Not for human or veterinary use.

Synonym

Synonyms2,4-dioxo-1H-pyrimidine-6-carboxylic acid

Property

Molecular Formula: C5H4N2O4
Molecular Weight156.10
Target:Nucleoside Antimetabolite/Analogue
SolubilityDMSO: 2 mg/mL, H2O: < 1 mg/mL
Purity≥95%
StorageRoom Temperature

Computed Descriptor

IUPAC Name2,4-dioxo-1H-pyrimidine-6-carboxylic acid
InChIInChI=1S/C5H4N2O4/c8-3-1-2(4(9)10)6-5(11)7-3/h1H,(H,9,10)(H2,6,7,8,11)
InChIKeyPXQPEWDEAKTCGB-UHFFFAOYSA-N
SMILESC1=C(NC(=O)NC1=O)C(=O)O