Ornithine-α-ketoglutarate (Cat.No:I033976) is a compound composed of ornithine and α-ketoglutarate, two important molecules involved in amino acid metabolism. It is commonly used as a dietary supplement and has been studied for its potential benefits in promoting muscle recovery, reducing fatigue, and supporting liver function. Ornithine-α-ketoglutarate is often used by athletes and fitness enthusiasts to enhance athletic performance and improve overall well-being.
| Catalog Number | I033976 |
| CAS Number | 5191-97-9 |
| Synonyms | OKG; L-Ornithine-α-ketoglutarate; L Ornithine α ketoglutarate; Ornithine-α-ketoglutarate; Ornithine α-ketoglutarate; Ornithine α ketoglutarate; Ornithine alpha ketoglutarate |
| Molecular Formula | C10H18N2O7 |
| Purity | 98% |
| Solubility | Soluble in DMSO |
| Appearance | Solid powder |
| Storage | Dry, dark and at 0 - 4 C for short term (days to weeks) or -20 C for long term (months to years). |
| IUPAC Name | (S)-2,5-Diaminopentanoic acid compound with 2-oxopentanedioic acid |
| InChI | InChI=1S/C5H12N2O2.C5H6O5/c6-3-1-2-4(7)5(8)9;6-3(5(9)10)1-2-4(7)8/h4H,1-3,6-7H2,(H,8,9);1-2H2,(H,7,8)(H,9,10)/t4-;/m0./s1 |
| InChIKey | SLPUVFBNQHVEEU-WCCKRBBISA-N |
| SMILES | O=C(O)[C@@H](N)CCCN.O=C(O)C(CCC(O)=O)=O |
| Reference | 1: Roch-Arveiller M, Tissot M, Coudray-Lucas C, Fontagné J, Le Boucher J, Giroud JP, Cynober L. Immunomodulatory effects of ornithine alpha-ketoglutarate in rats with burn injuries. Arch Surg. 1996 Jul;131(7):718-23. PubMed PMID: 8678770. |
