For research use only. Not for therapeutic Use.
Orexin Receptor Antagonist 3（Cat No.:I044685）is a selective small-molecule inhibitor targeting orexin receptors, particularly OX1R and/or OX2R, which regulate arousal, wakefulness, and appetite. By blocking orexin signaling, this compound promotes sleep initiation and maintenance, making it a potential therapeutic for insomnia and other sleep disorders. Orexin receptor antagonist 3 helps reduce the hyperarousal state without significantly impairing next-day functioning or causing dependency, a common issue with traditional sedative-hypnotics. It is primarily used in preclinical studies to evaluate the role of orexin pathways in sleep, anxiety, and metabolic regulation.
| CAS Number | 1293282-55-9 |
| Synonyms | [2-(4,6-dimethylpyrimidin-2-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-[2-nitro-6-(triazol-2-yl)phenyl]methanone |
| Molecular Formula | C21H22N8O3 |
| Purity | ≥95% |
| IUPAC Name | [2-(4,6-dimethylpyrimidin-2-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-[2-nitro-6-(triazol-2-yl)phenyl]methanone |
| InChI | InChI=1S/C21H22N8O3/c1-13-8-14(2)25-21(24-13)27-11-15-9-26(10-16(15)12-27)20(30)19-17(28-22-6-7-23-28)4-3-5-18(19)29(31)32/h3-8,15-16H,9-12H2,1-2H3 |
| InChIKey | MPDQVXKSEUGRGO-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NC(=N1)N2CC3CN(CC3C2)C(=O)C4=C(C=CC=C4[N+](=O)[O-])N5N=CC=N5)C |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
