For research use only. Not for therapeutic Use.
Opiranserin hydrochloride（Cat No.:I033927）is a selective serotonin 5-HT1A receptor antagonist, primarily investigated for its potential therapeutic effects on neurological and psychiatric disorders. By blocking the 5-HT1A receptor, it can modulate serotonin signaling, which plays a crucial role in mood regulation, anxiety, and stress responses. Opiranserin hydrochloride has been studied for its potential applications in treating conditions such as depression, anxiety disorders, and schizophrenia. It is used in research to explore the role of serotonin receptors in neuropsychiatric conditions and to evaluate its effectiveness in targeting specific neural pathways for therapeutic benefits.
| CAS Number | 1440796-75-7 |
| Synonyms | 4-butoxy-N-[[4-(dimethylamino)oxan-4-yl]methyl]-3,5-dimethoxybenzamide;hydrochloride |
| Molecular Formula | C21H35ClN2O5 |
| Purity | ≥95% |
| IUPAC Name | 4-butoxy-N-[[4-(dimethylamino)oxan-4-yl]methyl]-3,5-dimethoxybenzamide;hydrochloride |
| InChI | InChI=1S/C21H34N2O5.ClH/c1-6-7-10-28-19-17(25-4)13-16(14-18(19)26-5)20(24)22-15-21(23(2)3)8-11-27-12-9-21;/h13-14H,6-12,15H2,1-5H3,(H,22,24);1H |
| InChIKey | GSCGQHXDHYVKOL-UHFFFAOYSA-N |
| SMILES | CCCCOC1=C(C=C(C=C1OC)C(=O)NCC2(CCOCC2)N(C)C)OC.Cl |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
