For research use only. Not for therapeutic Use.
ONO-4059 analog(Cat No.:I001351)is a selective inhibitor of Bruton’s tyrosine kinase (BTK), similar to ONO-4059, which plays a key role in B-cell receptor signaling. By targeting BTK, this analog inhibits the activation and proliferation of B-cells, making it a valuable tool for studying B-cell malignancies such as chronic lymphocytic leukemia (CLL) and non-Hodgkin’s lymphoma. It also holds potential in research related to autoimmune diseases like rheumatoid arthritis, where B-cell activity is dysregulated. This analog is crucial for advancing the development of targeted therapies in oncology and immunology.
CAS Number | 1351635-67-0 |
Synonyms | (S)-9-(1-acryloylpiperidin-3-yl)-6-amino-7-(4-phenoxyphenyl)-7H-purin-8(9H)-one |
Molecular Formula | C₂₅H₂₄N₆O₃ |
Purity | ≥95% |
Target | Apoptosis |
Solubility | DMSO: ≥ 30 mg/mL |
Storage | Store at -20°C |
IC50 | sub-nM range |
IUPAC Name | 6-amino-7-(4-phenoxyphenyl)-9-[(3S)-1-prop-2-enoylpiperidin-3-yl]purin-8-one |
InChI | InChI=1S/C25H24N6O3/c1-2-21(32)29-14-6-7-18(15-29)31-24-22(23(26)27-16-28-24)30(25(31)33)17-10-12-20(13-11-17)34-19-8-4-3-5-9-19/h2-5,8-13,16,18H,1,6-7,14-15H2,(H2,26,27,28)/t18-/m0/s1 |
InChIKey | KSUDUUBCXJUFRL-SFHVURJKSA-N |
SMILES | C=CC(=O)N1CCC[C@@H](C1)N2C3=NC=NC(=C3N(C2=O)C4=CC=C(C=C4)OC5=CC=CC=C5)N |
Reference | <p style=/line-height:25px/> |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |