For research use only. Not for therapeutic Use.
ONO-0740556(Cat No.:I042295)is a selective inhibitor of the protein tyrosine phosphatase SHP2 (Src Homology 2 domain-containing Phosphatase 2), which plays a critical role in cell signaling, particularly in cancer cell growth, survival, and immune evasion. SHP2 is implicated in various cancer types, including those with mutations in the RAS pathway, where it contributes to tumorigenesis. ONO-0740556 aims to block SHP2’s function, thereby disrupting cancer cell signaling and potentially enhancing the effectiveness of existing cancer therapies. Preclinical studies suggest that it could offer a new approach in treating cancers resistant to other treatments.
CAS Number | 2250210-69-4 |
Synonyms | [(2R)-2-[5-(2-hexylphenyl)pentanoylamino]-3-hydroxypropyl] dihydrogen phosphate |
Molecular Formula | C20H34NO6P |
Purity | ≥95% |
IUPAC Name | [(2R)-2-[5-(2-hexylphenyl)pentanoylamino]-3-hydroxypropyl] dihydrogen phosphate |
InChI | InChI=1S/C20H34NO6P/c1-2-3-4-5-10-17-11-6-7-12-18(17)13-8-9-14-20(23)21-19(15-22)16-27-28(24,25)26/h6-7,11-12,19,22H,2-5,8-10,13-16H2,1H3,(H,21,23)(H2,24,25,26)/t19-/m1/s1 |
InChIKey | LYWONSBDWRVEKO-LJQANCHMSA-N |
SMILES | CCCCCCC1=CC=CC=C1CCCCC(=O)N[C@H](CO)COP(=O)(O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |