For research use only. Not for therapeutic Use.
Oncrasin-1 (Cat No.:I004801) is a potent and selective anticancer inhibitor that specifically targets human lung cancer cells with K-Ras mutations. It acts as an inhibitor of the K-Ras/PKCι pathway, inducing apoptosis and inhibiting tumor cell growth and survival. In vitro, studies have demonstrated its efficacy in killing lung cancer cells with K-Ras mutations at low concentrations, while in vivo administration has shown tumor growth suppression and prolonged survival in animal models. Oncrasin-1’s unique mechanism of action, involving abnormal aggregation of PKCι in sensitive cells, makes it a promising candidate for targeted therapy in K-Ras mutant lung cancer.
| CAS Number | 75629-57-1 |
| Synonyms | 1-[(4-chlorophenyl)methyl]indole-3-carbaldehyde |
| Molecular Formula | C16H12ClNO |
| Purity | ≥95% |
| Target | MAPK/ERK Pathway |
| Solubility | DMSO: ≥ 43 mg/mL |
| Storage | Store at 4°C |
| IC50 | 1.0 μM(A549, K-ras 12H and p53 Wt) |
| IUPAC Name | 1-[(4-chlorophenyl)methyl]indole-3-carbaldehyde |
| InChI | InChI=1S/C16H12ClNO/c17-14-7-5-12(6-8-14)9-18-10-13(11-19)15-3-1-2-4-16(15)18/h1-8,10-11H,9H2 |
| InChIKey | ZDRQMXCSSAPUMM-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CN2CC3=CC=C(C=C3)Cl)C=O |
| Reference | <p style=/line-height:25px/> |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |