For research use only. Not for therapeutic Use.
Omeprazole (Cat.No:A000620) is a proton pump inhibitor (PPI) widely used in research and therapy for acid-related conditions such as gastroesophageal reflux disease (GERD), peptic ulcers, and Zollinger-Ellison syndrome. It works by irreversibly inhibiting the H⁺/K⁺-ATPase enzyme in gastric parietal cells, effectively reducing stomach acid secretion. Omeprazole is also studied for its antioxidant and anti-inflammatory properties, making it valuable in exploring gastric mucosal protection. Its role in acid suppression has made it a cornerstone in understanding and managing gastrointestinal disorders.
| CAS Number | 73590-58-6 |
| Synonyms | 73590-58-6; Losec; Prilosec; Antra; Omeprazon |
| Molecular Formula | C17H19N3O3S |
| Purity | ≥95% |
| Target | Autophagy |
| Solubility | >17.3mg/mL in DMSO |
| Storage | -20°C |
| IUPAC Name | 6-methoxy-2-[(4-methoxy-3,5-dimethylpyridin-2-yl)methylsulfinyl]-1H-benzimidazole |
| InChI | 1S/C17H19N3O3S/c1-10-8-18-15(11(2)16(10)23-4)9-24(21)17-19-13-6-5-12(22-3)7-14(13)20-17/h5-8H,9H2,1-4H3,(H,19,20) |
| InChIKey | SUBDBMMJDZJVOS-UHFFFAOYSA-N |
| SMILES | CC1=CN=C(C(=C1OC)C)CS(=O)C2=NC3=C(N2)C=C(C=C3)OC |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
