For research use only. Not for therapeutic Use.
OM-153（Cat No.:I044150）is a potent and selective small-molecule inhibitor of tankyrase 1 and 2 (TNKS1/2), enzymes in the poly(ADP-ribose) polymerase (PARP) family that regulate Wnt/β-catenin signaling and telomere maintenance. By inhibiting tankyrases, OM-153 stabilizes Axin, a negative regulator of β-catenin, thereby suppressing Wnt-driven transcriptional activity. This makes OM-153 valuable in cancer research, particularly in tumors with aberrant Wnt signaling such as colorectal and pancreatic cancers. OM-153 is also studied for its potential role in fibrotic and metabolic diseases, offering therapeutic insight into tankyrase-mediated cellular processes and signaling regulation.
| CAS Number | 2406278-81-5 |
| Synonyms | N-[3-[5-(5-ethoxypyridin-2-yl)-4-(2-fluorophenyl)-1,2,4-triazol-3-yl]cyclobutyl]quinoxaline-5-carboxamide |
| Molecular Formula | C28H24FN7O2 |
| Purity | ≥95% |
| IUPAC Name | N-[3-[5-(5-ethoxypyridin-2-yl)-4-(2-fluorophenyl)-1,2,4-triazol-3-yl]cyclobutyl]quinoxaline-5-carboxamide |
| InChI | InChI=1S/C28H24FN7O2/c1-2-38-19-10-11-23(32-16-19)27-35-34-26(36(27)24-9-4-3-7-21(24)29)17-14-18(15-17)33-28(37)20-6-5-8-22-25(20)31-13-12-30-22/h3-13,16-18H,2,14-15H2,1H3,(H,33,37) |
| InChIKey | ARCOJIXZDJYBCH-UHFFFAOYSA-N |
| SMILES | CCOC1=CN=C(C=C1)C2=NN=C(N2C3=CC=CC=C3F)C4CC(C4)NC(=O)C5=C6C(=CC=C5)N=CC=N6 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
