For research use only. Not for therapeutic Use.
Olivetol (CAT: R046561)) is a naturally occurring alkylresorcinol with the molecular formula C₁₁H₁₆O₂. It appears as a white to off-white crystalline solid and is sparingly soluble in water but readily soluble in organic solvents. Olivetol serves as a key biosynthetic precursor in the formation of cannabinoids in certain plants and is widely used in research to synthesize cannabinoid analogs and derivatives. Beyond cannabinoid studies, it functions as an intermediate in pharmaceutical, fragrance, and fine chemical production. Its phenolic groups confer antioxidant and antimicrobial properties, while the alkyl side chain contributes to its hydrophobic character, making it valuable in diverse chemical applications.
| CAS Number | 500-66-3 |
| Synonyms | 3,5-Dihydroxyamylbenzene; 5-n-Amylresorcinol; 5-n-Pentylresorcinol; 1,3-Dihydroxy-5-pentylbenzene; 5-Pentyl-1,3-benzenediol; |
| Molecular Formula | C11H16O2 |
| Purity | ≥95% |
| Target | Neuronal Signaling |
| Storage | -20°C |
| IUPAC Name | 5-pentylbenzene-1,3-diol |
| InChI | InChI=1S/C11H16O2/c1-2-3-4-5-9-6-10(12)8-11(13)7-9/h6-8,12-13H,2-5H2,1H3 |
| InChIKey | IRMPFYJSHJGOPE-UHFFFAOYSA-N |
| SMILES | CCCCCC1=CC(=CC(=C1)O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |