Oil Yellow OB(Cat No.:M068846), also known as Solvent Yellow 14, is a synthetic dye belonging to the class of azo dyes. It is primarily used as a coloring agent in various industrial applications, including the dyeing of plastics, textiles, and fuels. Oil Yellow OB is characterized by its bright yellow hue and excellent solubility in organic solvents, making it suitable for use in oil-based formulations. Its versatility and stability make it a popular choice for coloring hydrophobic materials, such as oils, waxes, and greases. Additionally, it finds application in ink manufacturing and as a marker dye in laboratory research.
Catalog Number | M068846 |
CAS Number | 131-79-3 |
Molecular Formula | C17H15N3 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 1-[(2-methylphenyl)diazenyl]naphthalen-2-amine |
InChI | InChI=1S/C17H15N3/c1-12-6-2-5-9-16(12)19-20-17-14-8-4-3-7-13(14)10-11-15(17)18/h2-11H,18H2,1H3 |
InChIKey | BWLVSYUUKOQICP-UHFFFAOYSA-N |
SMILES | CC1=CC=CC=C1N=NC2=C(C=CC3=CC=CC=C32)N |