For research use only. Not for therapeutic Use.
Octadecyl Rhodamine B chloride(Cat No.:R071595)is a lipophilic fluorescent dye commonly used in cell biology and imaging studies. It binds to cellular membranes and can be used to stain live cells, particularly for examining membrane integrity, lipid bilayers, and cellular uptake processes. Due to its fluorescent properties, it allows researchers to visualize cellular structures and study cellular dynamics under a fluorescence microscope. Octadecyl Rhodamine B chloride is also used in assays to investigate membrane potential, endocytosis, and other membrane-related phenomena, making it a valuable tool in cell-based research.
CAS Number | 65603-19-2 |
Synonyms | [6-(diethylamino)-9-(2-octadecoxycarbonylphenyl)xanthen-3-ylidene]-diethylazanium;chloride |
Molecular Formula | C46H67ClN2O3 |
Purity | ≥95% |
IUPAC Name | [6-(diethylamino)-9-(2-octadecoxycarbonylphenyl)xanthen-3-ylidene]-diethylazanium;chloride |
InChI | InChI=1S/C46H67N2O3.ClH/c1-6-11-12-13-14-15-16-17-18-19-20-21-22-23-24-27-34-50-46(49)40-29-26-25-28-39(40)45-41-32-30-37(47(7-2)8-3)35-43(41)51-44-36-38(31-33-42(44)45)48(9-4)10-5;/h25-26,28-33,35-36H,6-24,27,34H2,1-5H3;1H/q+1;/p-1 |
InChIKey | NFGODEMQGQNUKK-UHFFFAOYSA-M |
SMILES | CCCCCCCCCCCCCCCCCCOC(=O)C1=CC=CC=C1C2=C3C=CC(=[N+](CC)CC)C=C3OC4=C2C=CC(=C4)N(CC)CC.[Cl-] |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |