For research use only. Not for therapeutic Use.
Oct3/4-inducer-1（Cat No.:I007930）is a synthetic small molecule identified for its ability to upregulate Oct3/4, a master transcription factor critical for maintaining pluripotency and self-renewal in embryonic stem cells. By enhancing Oct3/4 expression, this compound promotes stem cell-like properties and reprogramming potential, making it useful in regenerative medicine and stem cell biology research. Oct3/4-inducer-1 provides insights into transcriptional regulation, cellular plasticity, and the molecular mechanisms of induced pluripotent stem cell (iPSC) generation. It serves as a valuable tool for studying pluripotency pathways and developing reprogramming-based therapeutic strategies.
| CAS Number | 1016535-83-3 |
| Synonyms | 2-[4-[(4-fluorophenyl)methoxy]phenyl]acetonitrile |
| Molecular Formula | C15H12FNO |
| Purity | ≥95% |
| IUPAC Name | 2-[4-[(4-fluorophenyl)methoxy]phenyl]acetonitrile |
| InChI | InChI=1S/C15H12FNO/c16-14-5-1-13(2-6-14)11-18-15-7-3-12(4-8-15)9-10-17/h1-8H,9,11H2 |
| InChIKey | PXFUNIXWNXRVEJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CC#N)OCC2=CC=C(C=C2)F |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
