For research use only. Not for therapeutic Use.
O4I2 (CAT: I002167) is a potent inducer of Oct3/4 expression in various human cell lines, including human fibroblasts. Oct3/4, also known as POU5F1, is a critical transcription factor involved in maintaining pluripotency and self-renewal in embryonic stem cells. O4I2’s ability to induce Oct3/4 expression suggests its potential utility in cellular reprogramming or regenerative medicine applications, where the activation of pluripotency-associated genes is desirable. The compound’s specific mechanism of action and effects on cellular differentiation warrant further investigation for its potential role in stem cell research and related therapeutic strategies.
| CAS Number | 165682-93-9 |
| Synonyms | 2-[(4-chlorophenyl)amino]- 4-thiazolecarboxylic acid, ethyl ester |
| Molecular Formula | C12H11ClN2O2S |
| Purity | ≥95% |
| Target | Oct3/4 |
| Solubility | DMSO: ≥ 42 mg/mL |
| Storage | -20°C |
| IUPAC Name | ethyl 2-(4-chloroanilino)-1,3-thiazole-4-carboxylate |
| InChI | InChI=1S/C12H11ClN2O2S/c1-2-17-11(16)10-7-18-12(15-10)14-9-5-3-8(13)4-6-9/h3-7H,2H2,1H3,(H,14,15) |
| InChIKey | ULUBAPWNHROTEU-UHFFFAOYSA-N |
| SMILES | ClC1=CC=C(NC2=NC(C(OCC)=O)=CS2)C=C1 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
