For research use only. Not for therapeutic Use.
O-Succinyl-L-homoserine(Cat No.:M049613)is an intermediate compound in the biosynthesis of methionine, an essential amino acid. It plays a key role in the metabolic pathway known as the sulfur amino acid biosynthesis pathway. O-Succinyl-L-homoserine is formed from L-homoserine through the action of succinyl-CoA, and it is subsequently converted into homocysteine, which can further be used to synthesize methionine. This compound is of interest in biochemistry and biotechnology for understanding amino acid metabolism, as well as for its potential applications in microbial production systems that generate amino acids or other bioproducts.
| CAS Number | 1492-23-5 |
| Synonyms | (2S)-2-amino-4-(3-carboxypropanoyloxy)butanoic acid |
| Molecular Formula | C8H13NO6 |
| Purity | ≥95% |
| IUPAC Name | (2S)-2-amino-4-(3-carboxypropanoyloxy)butanoic acid |
| InChI | InChI=1S/C8H13NO6/c9-5(8(13)14)3-4-15-7(12)2-1-6(10)11/h5H,1-4,9H2,(H,10,11)(H,13,14)/t5-/m0/s1 |
| InChIKey | GNISQJGXJIDKDJ-YFKPBYRVSA-N |
| SMILES | C(COC(=O)CCC(=O)O)[C@@H](C(=O)O)N |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |