For research use only. Not for therapeutic Use.
o-Nitrofluorobenzene, or 2-fluoronitrobenzene (Cat No. :R015404), is an aromatic compound consisting of a benzene ring substituted with a nitro group at the ortho (2) position relative to a fluorine atom. It is a pale yellow liquid used as an intermediate in the synthesis of agrochemicals, dyes, and pharmaceuticals. The electron-withdrawing nitro group activates the ring for nucleophilic aromatic substitution, particularly at the fluorine position, making it valuable for forming carbon-nitrogen or carbon-oxygen bonds in heterocyclic and functionalized aromatic compounds.
| CAS Number | 1493-27-2 |
| Synonyms | 1-Fluoro-2-nitrobenzene; 2-Fluoro-1-nitrobenzene; 2-Fluoronitrobenzene; 2-Nitro-1-fluorobenzene; 2-Nitrofluorobenzene; 4-Fluoro-3-nitrobenzene; NSC 51869; o-Fluoronitrobenzene; |
| Molecular Formula | C6H4FNO2 |
| Purity | ≥95% |
| Storage | Desiccate at RT |
| IUPAC Name | 1-fluoro-2-nitrobenzene |
| InChI | InChI=1S/C6H4FNO2/c7-5-3-1-2-4-6(5)8(9)10/h1-4H |
| InChIKey | PWKNBLFSJAVFAB-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)[N+](=O)[O-])F |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
