For research use only. Not for therapeutic Use.
o-Methoxybenzonitrile(CAT: R070686) is a versatile aromatic nitrile widely employed as an intermediate in organic synthesis, particularly within pharmaceutical, agrochemical, and specialty chemical industries. Featuring a nitrile group adjacent to a methoxy substituent on the benzene ring, this compound exhibits enhanced reactivity and selectivity in numerous chemical transformations. Its distinct structural properties facilitate the synthesis of biologically active compounds, including pharmaceuticals and herbicides, by enabling efficient functional group conversions such as amidation, hydrolysis, and reduction.
| CAS Number | 6609-56-9 |
| Synonyms | 2-Methoxybenzonitrile |
| Molecular Formula | C8H7NO |
| Purity | ≥95% |
| Storage | RT |
| IUPAC Name | 2-methoxybenzonitrile |
| InChI | InChI=1S/C8H7NO/c1-10-8-5-3-2-4-7(8)6-9/h2-5H,1H3 |
| InChIKey | FSTPMFASNVISBU-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC=C1C#N |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |