For research use only. Not for therapeutic Use.
O-Ethyl S-((6-(trifluoromethyl)pyridin-3-yl)methyl) carbonodithioate (Cat.No:L004165) is a pivotal compound in chemical synthesis. Its unique structure, featuring a carbonodithioate and a trifluoromethylpyridine, imparts specialized reactivity. This compound serves as a valuable building block in the creation of specialized molecules with various industrial and pharmaceutical applications.
| CAS Number | 2107987-82-4 |
| Molecular Formula | C10H10F3NOS2 |
| Purity | ≥95% |
| IUPAC Name | O-ethyl [6-(trifluoromethyl)pyridin-3-yl]methylsulfanylmethanethioate |
| InChI | InChI=1S/C10H10F3NOS2/c1-2-15-9(16)17-6-7-3-4-8(14-5-7)10(11,12)13/h3-5H,2,6H2,1H3 |
| InChIKey | VFEBMWWBMBZJNB-UHFFFAOYSA-N |
| SMILES | CCOC(=S)SCC1=CN=C(C=C1)C(F)(F)F |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |