For research use only. Not for therapeutic Use.
O-(2-Aminoethyl)-L-serine Hydrochloride(Cat No.:M017633)is a high-purity compound used in biochemical and pharmaceutical research, particularly in the study of amino acid metabolism and cell signaling. As a derivative of serine, it features an aminoethyl group attached to the serine backbone, enhancing its ability to interact with biological systems. This compound is often used in peptide synthesis, enzyme inhibition studies, and as a building block for the development of bioactive molecules. Its stable form as a hydrochloride salt ensures solubility and ease of use in various experimental applications.
| CAS Number | 118021-35-5 |
| Molecular Formula | C5H13ClN2O3 |
| Purity | ≥95% |
| Target | Fungal |
| Storage | -20°C |
| IUPAC Name | (2S)-2-amino-3-(2-aminoethoxy)propanoic acid;hydrochloride |
| InChI | InChI=1S/C5H12N2O3.ClH/c6-1-2-10-3-4(7)5(8)9;/h4H,1-3,6-7H2,(H,8,9);1H/t4-;/m0./s1 |
| InChIKey | OVHJSRSTAWFIIF-WCCKRBBISA-N |
| SMILES | C(COC[C@@H](C(=O)O)N)N.Cl |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |