For research use only. Not for therapeutic Use.
NY2267（Cat No.:I044524）is a synthetic small-molecule compound developed as a selective inhibitor of histone deacetylases (HDACs), enzymes involved in removing acetyl groups from histone and non-histone proteins. By inhibiting HDAC activity, NY2267 promotes hyperacetylation of histones, leading to a more open chromatin structure and altered gene expression. It has shown potential in preclinical models for treating cancer by inducing cell cycle arrest, apoptosis, and differentiation. NY2267 is useful in epigenetic research and therapeutic development targeting transcriptional dysregulation in malignancies and other diseases associated with aberrant histone modification.
| CAS Number | 886053-73-2 |
| Synonyms | tert-butyl 2-[6-[2-(cyclohexylamino)-1-[(4-methoxyphenyl)methyl-(pyridine-2-carbonyl)amino]-2-oxoethyl]naphthalen-2-yl]oxyacetate |
| Molecular Formula | C38H43N3O6 |
| Purity | ≥95% |
| IUPAC Name | tert-butyl 2-[6-[2-(cyclohexylamino)-1-[(4-methoxyphenyl)methyl-(pyridine-2-carbonyl)amino]-2-oxoethyl]naphthalen-2-yl]oxyacetate |
| InChI | InChI=1S/C38H43N3O6/c1-38(2,3)47-34(42)25-46-32-20-17-27-22-29(16-15-28(27)23-32)35(36(43)40-30-10-6-5-7-11-30)41(37(44)33-12-8-9-21-39-33)24-26-13-18-31(45-4)19-14-26/h8-9,12-23,30,35H,5-7,10-11,24-25H2,1-4H3,(H,40,43) |
| InChIKey | RVGDACCXDZIPOB-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)COC1=CC2=C(C=C1)C=C(C=C2)C(C(=O)NC3CCCCC3)N(CC4=CC=C(C=C4)OC)C(=O)C5=CC=CC=N5 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
