For research use only. Not for therapeutic Use.
NVS-STG2(CAT: I040266) is a novel molecular glue that selectively targets and activates human STING (Stimulator of Interferon Genes), a key adaptor protein in innate immune signaling. By binding to interfacial pockets between adjacent STING dimer transmembrane domains, NVS-STG2 induces higher-order oligomerization of STING, amplifying downstream signaling. It synergizes with endogenous cGAMP, enhancing STING activation and promoting robust type I interferon responses. NVS-STG2 exhibits antitumor activity in animal models, making it a promising candidate for immuno-oncology research. This compound is ideal for exploring innate immunity, STING pathway biology, and immune-mediated cancer therapy.
| CAS Number | 3030588-01-0 |
| Synonyms | 4-[[4-(2-tert-butyl-5,5-dimethyl-1,3-dioxan-2-yl)phenyl]methylamino]-3-methoxybenzoic acid |
| Molecular Formula | C25H33NO5 |
| Purity | ≥95% |
| IUPAC Name | 4-[[4-(2-tert-butyl-5,5-dimethyl-1,3-dioxan-2-yl)phenyl]methylamino]-3-methoxybenzoic acid |
| InChI | InChI=1S/C25H33NO5/c1-23(2,3)25(30-15-24(4,5)16-31-25)19-10-7-17(8-11-19)14-26-20-12-9-18(22(27)28)13-21(20)29-6/h7-13,26H,14-16H2,1-6H3,(H,27,28) |
| InChIKey | CZSPKEVHLRWAFC-UHFFFAOYSA-N |
| SMILES | CC1(COC(OC1)(C2=CC=C(C=C2)CNC3=C(C=C(C=C3)C(=O)O)OC)C(C)(C)C)C |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
