For research use only. Not for therapeutic Use.
NSC639828（Cat No.:M114287）is a benzoylphenylurea derivative and DNA polymerase α inhibitor with an IC₅₀ of about 70 µM. It also inhibits E. coli DNA polymerase I and calf thymus DNA polymerase α, though excess enzyme reduces its inhibitory effect. NSC639828 shows notable antitumor activity in preclinical studies, making it a useful compound in cancer research. Its molecular formula is C₁₈H₁₃BrClN₅O₃, with a molecular weight of ~462.7 g/mol. The compound is intended for research use only and is typically supplied as a high-purity solid for biochemical and pharmacological investigation.
| CAS Number | 134742-26-0 |
| Synonyms | 2-amino-N-[[4-(5-bromopyrimidin-2-yl)oxy-3-chlorophenyl]carbamoyl]benzamide |
| Molecular Formula | C18H13BrClN5O3 |
| Purity | ≥95% |
| IUPAC Name | 2-amino-N-[[4-(5-bromopyrimidin-2-yl)oxy-3-chlorophenyl]carbamoyl]benzamide |
| InChI | InChI=1S/C18H13BrClN5O3/c19-10-8-22-18(23-9-10)28-15-6-5-11(7-13(15)20)24-17(27)25-16(26)12-3-1-2-4-14(12)21/h1-9H,21H2,(H2,24,25,26,27) |
| InChIKey | LRPFTPYFADHGQJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)NC(=O)NC2=CC(=C(C=C2)OC3=NC=C(C=N3)Br)Cl)N |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
