For research use only. Not for therapeutic Use.
NSC-13755 (Cat.No:I012348) is a chemical compound that has been studied for its potential anticancer properties. It belongs to the class of aromatic hydrazides and exhibits cytotoxic effects against various cancer cell lines. NSC-13755 has shown promise in inhibiting tumor growth and inducing apoptosis in preclinical studies, highlighting its potential as a candidate for further research in cancer therapeutics.
| CAS Number | 5430-24-0 |
| Synonyms | 2-Nitro-4-stibonobenzoic acid, 4-(Dihydroxy(oxido)stibino)-2-(hydroxy(oxido)amino)benzoic acid |
| Molecular Formula | C7H6NO7Sb |
| Purity | ≥95% |
| IUPAC Name | 2-nitro-4-stibonobenzoic acid |
| InChI | InChI=1S/C7H4NO4.2H2O.O.Sb/c9-7(10)5-3-1-2-4-6(5)8(11)12;;;;/h1,3-4H,(H,9,10);2*1H2;;/q;;;;+2/p-2 |
| InChIKey | HUAYIYWLCZXNRE-UHFFFAOYSA-L |
| SMILES | C1=CC(=C(C=C1[Sb](=O)(O)O)[N+](=O)[O-])C(=O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
