For research use only. Not for therapeutic Use.
NS2B/NS3-IN-3 Hydrochloride(CAT: I040625) is a potent small-molecule inhibitor targeting the NS2B/NS3 protease complex, a critical viral enzyme required for replication and maturation in flaviviruses such as dengue virus, Zika virus, and West Nile virus. By inhibiting this serine protease, NS2B/NS3-IN-3 disrupts polyprotein processing and viral propagation, making it a valuable antiviral candidate for preclinical research. The hydrochloride salt form enhances solubility and stability, supporting its use in both in vitro enzymatic assays and cell-based antiviral studies. NS2B/NS3-IN-3 is a key tool for virology, antiviral drug discovery, and mechanistic investigations of flavivirus life cycles.
| CAS Number | 2832876-91-0 |
| Synonyms | 6-(furan-3-yl)-N-(piperidin-4-ylmethyl)-1H-indole-2-carboxamide;hydrochloride |
| Molecular Formula | C19H22ClN3O2 |
| Purity | ≥95% |
| IUPAC Name | 6-(furan-3-yl)-N-(piperidin-4-ylmethyl)-1H-indole-2-carboxamide;hydrochloride |
| InChI | InChI=1S/C19H21N3O2.ClH/c23-19(21-11-13-3-6-20-7-4-13)18-10-15-2-1-14(9-17(15)22-18)16-5-8-24-12-16;/h1-2,5,8-10,12-13,20,22H,3-4,6-7,11H2,(H,21,23);1H |
| InChIKey | ILKRKFAPUXCGDZ-UHFFFAOYSA-N |
| SMILES | C1CNCCC1CNC(=O)C2=CC3=C(N2)C=C(C=C3)C4=COC=C4.Cl |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
