For research use only. Not for therapeutic Use.
NS 9283（Cat No.:R014426）is a positive allosteric modulator of the α4β2 nicotinic acetylcholine receptor (nAChR), a receptor subtype involved in cognitive function, attention, and neurological signaling. Unlike direct agonists, NS 9283 enhances the receptor’s response to acetylcholine without activating it independently, offering more physiological control over receptor activity. It selectively targets the low-sensitivity (α4)₃(β2)₂ stoichiometry of α4β2 nAChRs. NS 9283 is widely used in neuroscience research to explore synaptic plasticity, learning, memory, and potential therapeutic strategies for cognitive disorders such as Alzheimer’s disease, schizophrenia, and attention deficit disorders.
| CAS Number | 913830-15-6 |
| Synonyms | 3-(3-pyridin-3-yl-1,2,4-oxadiazol-5-yl)benzonitrile |
| Molecular Formula | C14H8N4O |
| Purity | ≥95% |
| IUPAC Name | 3-(3-pyridin-3-yl-1,2,4-oxadiazol-5-yl)benzonitrile |
| InChI | InChI=1S/C14H8N4O/c15-8-10-3-1-4-11(7-10)14-17-13(18-19-14)12-5-2-6-16-9-12/h1-7,9H |
| InChIKey | HGFXDSQLRSWUBO-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C2=NC(=NO2)C3=CN=CC=C3)C#N |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
