For research use only. Not for therapeutic Use.
NRX-1933（Cat No.:I043867）is a selective small molecule designed to modulate the activation of specific G protein-coupled receptors (GPCRs), particularly those involved in neuroinflammation and neurological diseases. It is primarily being investigated for its potential therapeutic effects in treating psychiatric and neurological conditions, such as depression, anxiety, and schizophrenia. By targeting key receptors involved in the regulation of mood and cognition, NRX-1933 aims to balance neurotransmitter signaling and alleviate symptoms associated with these disorders. It is currently undergoing preclinical studies to assess its efficacy and safety for future clinical use in neuropsychiatric therapies.
| CAS Number | 2763260-30-4 |
| Synonyms | 2-oxo-N-[3-(2H-tetrazol-5-yl)phenyl]-6-(trifluoromethyl)-1H-pyridine-3-carboxamide |
| Molecular Formula | C14H9F3N6O2 |
| Purity | ≥95% |
| IUPAC Name | 2-oxo-N-[3-(2H-tetrazol-5-yl)phenyl]-6-(trifluoromethyl)-1H-pyridine-3-carboxamide |
| InChI | InChI=1S/C14H9F3N6O2/c15-14(16,17)10-5-4-9(13(25)19-10)12(24)18-8-3-1-2-7(6-8)11-20-22-23-21-11/h1-6H,(H,18,24)(H,19,25)(H,20,21,22,23) |
| InChIKey | IAVMZDPIQIVLOG-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)NC(=O)C2=CC=C(NC2=O)C(F)(F)F)C3=NNN=N3 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
