For research use only. Not for therapeutic Use.
NRP1 Antagonist 2（Cat No.:I043654）is a selective inhibitor designed to target neuropilin-1 (NRP1), a cell surface receptor involved in various biological processes such as angiogenesis, tumor progression, and immune response regulation. By blocking NRP1, this antagonist disrupts the signaling pathways that promote tumor growth, metastasis, and endothelial cell migration. NRP1 Antagonist 2 is primarily investigated for its potential to enhance cancer therapies by inhibiting angiogenesis and tumor vascularization. It is used in preclinical studies to explore new approaches for treating cancers and diseases where NRP1 plays a key role in pathogenesis.
| CAS Number | 483289-96-9 |
| Synonyms | 2-[[4-(3-chlorophenyl)-5-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-(5-ethyl-1,3,4-thiadiazol-2-yl)acetamide |
| Molecular Formula | C20H17ClN6OS2 |
| Purity | ≥95% |
| IUPAC Name | 2-[[4-(3-chlorophenyl)-5-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-(5-ethyl-1,3,4-thiadiazol-2-yl)acetamide |
| InChI | InChI=1S/C20H17ClN6OS2/c1-2-17-23-25-19(30-17)22-16(28)12-29-20-26-24-18(13-7-4-3-5-8-13)27(20)15-10-6-9-14(21)11-15/h3-11H,2,12H2,1H3,(H,22,25,28) |
| InChIKey | CTRUPGGFDZUABL-UHFFFAOYSA-N |
| SMILES | CCC1=NN=C(S1)NC(=O)CSC2=NN=C(N2C3=CC(=CC=C3)Cl)C4=CC=CC=C4 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
