For research use only. Not for therapeutic Use.
Nrf2-ARE/hMAO-B/QR2 Modulator 1（Cat No.:I043880）is a small molecule designed to modulate multiple cellular pathways, primarily focusing on the Nrf2-antioxidant response element (ARE) pathway, as well as inhibiting human monoamine oxidase B (hMAO-B) and quinone reductase 2 (QR2). By activating Nrf2-ARE, it enhances cellular antioxidant defenses, which may provide neuroprotective effects. Simultaneously, inhibiting hMAO-B and QR2 may help reduce oxidative stress and inflammation, making this modulator a promising candidate in research for treating neurodegenerative diseases like Parkinson’s and Alzheimer’s, as well as other conditions associated with oxidative damage.
| CAS Number | 3035124-25-2 |
| Synonyms | 5-[(E)-2-(4-methoxyphenyl)ethenyl]-3-prop-2-ynyl-1,3,4-oxadiazol-2-one |
| Molecular Formula | C14H12N2O3 |
| Purity | ≥95% |
| IUPAC Name | 5-[(E)-2-(4-methoxyphenyl)ethenyl]-3-prop-2-ynyl-1,3,4-oxadiazol-2-one |
| InChI | InChI=1S/C14H12N2O3/c1-3-10-16-14(17)19-13(15-16)9-6-11-4-7-12(18-2)8-5-11/h1,4-9H,10H2,2H3/b9-6+ |
| InChIKey | SFKGQKWKUGEJCM-RMKNXTFCSA-N |
| SMILES | COC1=CC=C(C=C1)/C=C/C2=NN(C(=O)O2)CC#C |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
