For research use only. Not for therapeutic Use.
Nrf2 Activator-2（Cat No.:I043852）is a small molecule designed to activate the Nrf2 (nuclear factor erythroid 2-related factor 2) pathway, a crucial regulator of cellular antioxidant responses and detoxification processes. By stimulating Nrf2, this activator enhances the expression of protective enzymes involved in reducing oxidative stress, inflammation, and cellular damage. Nrf2 Activator-2 is primarily being studied for its potential therapeutic applications in neurodegenerative diseases, cardiovascular conditions, and cancer prevention, where oxidative stress plays a major role. It holds promise for developing treatments that support cellular defense mechanisms and promote overall health.
| CAS Number | 2770448-53-6 |
| Synonyms | 6-bromo-8,8-dimethyl-3-phenyl-9,10-dihydropyrano[2,3-h]chromen-2-one |
| Molecular Formula | C20H17BrO3 |
| Purity | ≥95% |
| IUPAC Name | 6-bromo-8,8-dimethyl-3-phenyl-9,10-dihydropyrano[2,3-h]chromen-2-one |
| InChI | InChI=1S/C20H17BrO3/c1-20(2)9-8-14-17-13(11-16(21)18(14)24-20)10-15(19(22)23-17)12-6-4-3-5-7-12/h3-7,10-11H,8-9H2,1-2H3 |
| InChIKey | AWBUMGZRUKQFIN-UHFFFAOYSA-N |
| SMILES | CC1(CCC2=C3C(=CC(=C2O1)Br)C=C(C(=O)O3)C4=CC=CC=C4)C |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
