For research use only. Not for therapeutic Use.
NPPM 6748-481（Cat No.:R028720）is a small molecule inhibitor designed to target specific enzymes or signaling pathways involved in cellular processes such as proliferation, survival, and inflammation. It is primarily investigated for its potential therapeutic effects in cancer and autoimmune diseases, where dysregulated signaling contributes to disease progression. By inhibiting its molecular targets, NPPM 6748-481 disrupts key pathways, offering potential benefits in controlling tumor growth and modulating immune responses. It is used in preclinical studies to assess its efficacy as a targeted treatment strategy for cancer and related conditions.
| CAS Number | 432020-20-7 |
| Synonyms | (4-chloro-3-nitrophenyl)-[4-(2-fluorophenyl)piperazin-1-yl]methanone |
| Molecular Formula | C17H15ClFN3O3 |
| Purity | ≥95% |
| IUPAC Name | (4-chloro-3-nitrophenyl)-[4-(2-fluorophenyl)piperazin-1-yl]methanone |
| InChI | InChI=1S/C17H15ClFN3O3/c18-13-6-5-12(11-16(13)22(24)25)17(23)21-9-7-20(8-10-21)15-4-2-1-3-14(15)19/h1-6,11H,7-10H2 |
| InChIKey | LSPJXCGEFJDMHA-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1C2=CC=CC=C2F)C(=O)C3=CC(=C(C=C3)Cl)[N+](=O)[O-] |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
