For research use only. Not for therapeutic Use.
NPD9948(CAT: I011969) is a high-purity chemical compound vital for advanced pharmaceutical and biochemical research. This compound is essential for studying metabolic pathways, enzyme interactions, and drug development processes. It provides precise and reliable analytical results due to its exceptional purity and stability. Ideal for synthetic chemistry and pharmacological studies, NPD9948 integrates seamlessly into existing research protocols, offering a robust and cost-effective solution for high-precision scientific investigations. Optimize your research accuracy and outcomes with the reliable and versatile NPD9948.
| CAS Number | 59856-85-8 |
| Synonyms | NPD9948; NPD-9948; NPD 9948;;N6-Phenethyl-9H-purine-2,6-diamine |
| Molecular Formula | C13H14N6 |
| Purity | ≥95% |
| Target | MTH1 inhibitor |
| Solubility | Soluble in DMSO |
| Storage | Store at 0-8 °C |
| IUPAC Name | 6-N-(2-phenylethyl)-7H-purine-2,6-diamine |
| InChI | InChI=1S/C13H14N6/c14-13-18-11(10-12(19-13)17-8-16-10)15-7-6-9-4-2-1-3-5-9/h1-5,8H,6-7H2,(H4,14,15,16,17,18,19) |
| InChIKey | VVAAYEZVIGGGED-UHFFFAOYSA-N |
| SMILES | NC1=NC(NCCC2=CC=CC=C2)=C3N=CNC3=N1 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |