For research use only. Not for therapeutic Use.
Nostopeptin B (Cat No.: I033479) is a cyclic peptide isolated from Nostoc cyanobacteria, known for its bioactive properties. It belongs to the family of microcystin-like peptides and exhibits cytotoxic and antimicrobial activities. Structurally, it contains unique non-proteinogenic amino acids, contributing to its biological potency. Nostopeptin B is studied for its potential role in cancer research and microbial inhibition. Its mechanism of action involves interactions with cellular enzymes, making it a valuable compound for investigating toxin-related pathophysiology and novel therapeutic developments.
CAS Number | 185980-89-6 |
Synonyms | Nostopeptin B; |
Molecular Formula | C46H70N8O12 |
Purity | 98% |
Solubility | Soluble in DMSO |
Appearance | Solid powder |
Storage | Dry, dark and at 0 - 4 C for short term (days to weeks) or -20 C for long term (months to years). |
IUPAC Name | L-Isoleucine, N2-acetyl-L-glutaminyl-3-hydroxy-4-methylprolyl-L-leucyl-(alphaS)-3-amino-6-hydroxy-alpha-((1S)-1-methylpropyl)-2-oxo-1-piperidineacetyl-N-methyl-L-tyrosyl-, (6-2)-lactone |
InChI | InChI=1S/C46H70N8O12/c1-10-24(5)36-46(65)66-39-26(7)22-53(43(62)30(48-27(8)55)16-18-34(47)57)38(39)42(61)50-32(20-23(3)4)40(59)49-31-17-19-35(58)54(44(31)63)37(25(6)11-2)45(64)52(9)33(41(60)51-36)21-28-12-14-29(56)15-13-28/h12-15,23-26,30-33,35-39,56,58H,10-11,16-22H2,1-9H3,(H2,47,57)(H,48,55)(H,49,59)(H,50,61)(H,51,60)/t24-,25-,26-,30-,31-,32-,33-,35+,36-,37-,38-,39-/m0/s1 |
InChIKey | QMXYZAMGCKYKHQ-PYYLCICISA-N |
SMILES | CC[C@@H]([C@@H]1NC([C@@H](N(C([C@@H](N2[C@@H](CC[C@@H](C2=O)NC([C@@H](NC([C@@H]3[C@H]([C@H](CN3C([C@@H](NC(C)=O)CCC(N)=O)=O)C)OC1=O)=O)CC(C)C)=O)O)[C@H](CC)C)=O)C)Cc4ccc(O)cc4)=O)C |
Reference | 1: von Elert E, Oberer L, Merkel P, Huhn T, Blom JF. Cyanopeptolin 954, a chlorine-containing chymotrypsin inhibitor of Microcystis aeruginosa NIVA Cya 43. J Nat Prod. 2005 Sep;68(9):1324-7. PubMed PMID: 16180807. |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |