For research use only. Not for therapeutic Use.
(+)-Nortrachelogenin（Cat No.:R023005）is a lignan compound primarily isolated from plants of the Schisandraceae and Magnoliaceae families. As a dibenzylbutyrolactone-type lignan, it exhibits a range of biological activities, including anti-inflammatory, antioxidant, and anticancer effects. (+)-Nortrachelogenin has been shown to inhibit nitric oxide production and pro-inflammatory cytokines, suggesting potential in treating inflammation-related diseases. It also demonstrates cytotoxicity against various cancer cell lines by modulating apoptosis-related pathways. Its structural similarity to other phytoestrogens hints at possible hormone-related activities, making it a valuable lead for drug discovery in oncology and immunomodulatory research.
| CAS Number | 61521-74-2 |
| Synonyms | (3R,4R)-3-hydroxy-3,4-bis[(4-hydroxy-3-methoxyphenyl)methyl]oxolan-2-one |
| Molecular Formula | C20H22O7 |
| Purity | ≥95% |
| IUPAC Name | (3R,4R)-3-hydroxy-3,4-bis[(4-hydroxy-3-methoxyphenyl)methyl]oxolan-2-one |
| InChI | InChI=1S/C20H22O7/c1-25-17-8-12(3-5-15(17)21)7-14-11-27-19(23)20(14,24)10-13-4-6-16(22)18(9-13)26-2/h3-6,8-9,14,21-22,24H,7,10-11H2,1-2H3/t14-,20-/m1/s1 |
| InChIKey | ZITBJWXLODLDRH-JLTOFOAXSA-N |
| SMILES | COC1=C(C=CC(=C1)C[C@@H]2COC(=O)[C@]2(CC3=CC(=C(C=C3)O)OC)O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
