For research use only. Not for therapeutic Use.
Norisoboldine(Cat No.:I002791)is a bioactive alkaloid extracted from the traditional Chinese medicinal herb Radix Linderae. It is renowned for its anti-inflammatory and immunomodulatory properties. Norisoboldine inhibits the production of pro-inflammatory cytokines and modulates immune cell activity, making it effective in treating inflammatory diseases such as rheumatoid arthritis. Additionally, it has shown potential in managing pain and preventing bone erosion. As a natural compound with minimal side effects, Norisoboldine offers a promising therapeutic approach for chronic inflammatory conditions, contributing to advancements in herbal medicine and pharmacological research.
| CAS Number | 23599-69-1 |
| Molecular Formula | C18H19NO4 |
| Purity | ≥95% |
| Target | Adenosine Receptor |
| Solubility | DMSO |
| Storage | Store at -20°C |
| IUPAC Name | (6aS)-2,10-dimethoxy-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinoline-1,9-diol |
| InChI | InChI=1S/C18H19NO4/c1-22-14-8-11-10(6-13(14)20)5-12-16-9(3-4-19-12)7-15(23-2)18(21)17(11)16/h6-8,12,19-21H,3-5H2,1-2H3/t12-/m0/s1 |
| InChIKey | HORZNQYQXBFWNZ-LBPRGKRZSA-N |
| SMILES | COC1=C(C2=C3C(CC4=CC(=C(C=C42)OC)O)NCCC3=C1)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |