For research use only. Not for therapeutic Use.
Norepinephrine(CAT: I008327) is an organic chemical in the catecholamine family that functions in the human brain and body as a hormone and neurotransmitter. Norepinephrine directly stimulates adrenergic receptors. Stimulation of alpha-adrenergic receptors causes vasoconstriction of the radial smooth muscle of the iris, arteries, arterioles, veins, urinary bladder, and the sphincter of the gastrointestinal tract. Stimulation of beta-1 adrenergic receptors causes an increase in myocardial contractility, heart rate, automaticity, and atrioventricular (AV) conduction while stimulation of beta-2 adrenergic receptors causes bronchiolar and vascular smooth muscle dilatation.
CAS Number | 51-41-2 |
Synonyms | Norepinephrine, Noradrenaline, Noradrenalin, Levarterenol, Levophed;4-[(1R)-2-amino-1-hydroxyethyl]benzene-1,2-diol |
Molecular Formula | C8H11NO3 |
Purity | ≥95% |
Target | Metabolic Enzyme/Protease |
Solubility | Soluble in DMSO, not in water |
Storage | 0 - 4 °C for short term, or -20 °C for long term |
IUPAC Name | 4-[(1R)-2-amino-1-hydroxyethyl]benzene-1,2-diol |
InChI | InChI=1S/C8H11NO3/c9-4-8(12)5-1-2-6(10)7(11)3-5/h1-3,8,10-12H,4,9H2/t8-/m0/s1 |
InChIKey | SFLSHLFXELFNJZ-QMMMGPOBSA-N |
SMILES | C1=CC(=C(C=C1C(CN)O)O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |