For research use only. Not for therapeutic Use.
Nordalbergin(CAT: R072387) is a naturally occurring phenolic compound classified as a coumarin derivative, identified in various plant sources. As a bioactive natural product, it has been reported to exhibit antioxidant, anti-inflammatory, and potential cytoprotective properties, making it a promising lead for pharmacological studies. Nordalbergin’s phenolic structure contributes to its ability to scavenge free radicals and modulate cellular signaling pathways associated with oxidative stress. It is a valuable compound for research in natural products chemistry, pharmacognosy, and drug discovery, particularly in the context of inflammation, oxidative stress, and chronic disease models where coumarin-based metabolites play important biological roles.
| CAS Number | 482-82-6 |
| Synonyms | 6,7-dihydroxy-4-phenylchromen-2-one |
| Molecular Formula | C15H10O4 |
| Purity | ≥95% |
| IUPAC Name | 6,7-dihydroxy-4-phenylchromen-2-one |
| InChI | InChI=1S/C15H10O4/c16-12-6-11-10(9-4-2-1-3-5-9)7-15(18)19-14(11)8-13(12)17/h1-8,16-17H |
| InChIKey | TZRNJQYCOSMOJS-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC(=O)OC3=CC(=C(C=C23)O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
