For research use only. Not for therapeutic Use.
Norbiotinamine(CAT: I016847) is a structural analog of biotin designed as an alternative probe for peptide modification and bioconjugation. Unlike biotin, which couples through an amino group, Norbiotinamine contains a reactive amine that couples with the carboxyl group of amino acids, enabling the synthesis of inverse peptides with amide linkages oriented in the opposite direction. This unique feature allows exploration of peptide backbone orientation and stability in biochemical systems. For example, Norbiotinamine can couple with the NHS ester of N-Boc-glutamic acid γ-benzyl ester to yield a norbiotinylamide derivative, structurally similar to biocytin but with a shorter chain and inverted amide bond.
| CAS Number | 173401-47-3 |
| Synonyms | (3aS,4S,6aR)-4-(4-aminobutyl)-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-2-one |
| Molecular Formula | C9H17N3OS |
| Purity | ≥95% |
| IUPAC Name | (3aS,4S,6aR)-4-(4-aminobutyl)-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-2-one |
| InChI | InChI=1S/C9H17N3OS/c10-4-2-1-3-7-8-6(5-14-7)11-9(13)12-8/h6-8H,1-5,10H2,(H2,11,12,13)/t6-,7-,8-/m0/s1 |
| InChIKey | KRWAZHNVQMITHZ-FXQIFTODSA-N |
| SMILES | C1C2C(C(S1)CCCCN)NC(=O)N2 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
