For research use only. Not for therapeutic Use.
N,N-Dimethyldiethylenetriamine (Cat.No:L003852) is a vital chemical compound with diverse applications. Its structure, comprising tertiary amine groups, imparts versatile reactivity. This compound serves as a key building block in the synthesis of various specialized chemicals, including corrosion inhibitors, chelating agents, and catalysts. Its wide-ranging utility in industries such as pharmaceuticals and agrochemicals highlights its importance in chemical research.
| CAS Number | 24229-53-6 |
| Molecular Formula | C6H17N3 |
| Purity | ≥95% |
| IUPAC Name | N'-[2-(dimethylamino)ethyl]ethane-1,2-diamine |
| InChI | InChI=1S/C6H17N3/c1-9(2)6-5-8-4-3-7/h8H,3-7H2,1-2H3 |
| InChIKey | HLTMVWQXGLNLCU-UHFFFAOYSA-N |
| SMILES | CN(C)CCNCCN |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
