For research use only. Not for therapeutic Use.
N,N-Dimethyl-p-toluidine is an organic compound. It is commonly used as a catalyst and curing agent in various chemical processes, including the production of polymers, resins, and adhesives. Additionally, N,N-Dimethyl-p-toluidine finds application as a component in dental materials, such as dental composites and adhesives. Its ability to initiate and accelerate curing reactions, coupled with its low toxicity and stability, makes it a valuable additive in industries ranging from plastics and coatings to healthcare and dentistry.
| CAS Number | 99-97-8 |
| Synonyms | 4-Dimethylaminotoluene |
| Molecular Formula | C9H13N |
| Purity | ≥95% |
| Storage | RT |
| IUPAC Name | N,N,4-trimethylaniline |
| InChI | InChI=1S/C9H13N/c1-8-4-6-9(7-5-8)10(2)3/h4-7H,1-3H3 |
| InChIKey | GYVGXEWAOAAJEU-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)N(C)C |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |