For research use only. Not for therapeutic Use.
N, N-Dimethyl-2-furfurylamine(Cat No.:M052894) is an organic compound with the chemical formula C7H11NO. It features a furan ring, a five-membered aromatic ring with oxygen, attached to an amine group that is dimethylated. This colorless liquid is known for its distinct, slightly unpleasant odor. It serves primarily as an intermediate in the synthesis of pharmaceuticals, agrochemicals, and various organic compounds. Its ability to act as a building block for more complex molecules makes it valuable in organic synthesis, particularly in the production of drugs and crop protection agents.
CAS Number | 14496-34-5 |
Molecular Formula | C7H11NO |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 1-(furan-2-yl)-N,N-dimethylmethanamine |
InChI | InChI=1S/C7H11NO/c1-8(2)6-7-4-3-5-9-7/h3-5H,6H2,1-2H3 |
InChIKey | VFIAOIVGTFADLM-UHFFFAOYSA-N |
SMILES | CN(C)CC1=CC=CO1 |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |