For research use only. Not for therapeutic Use.
N,N-Diethylbenzamide-d5 is a deuterated analog of N,N-diethylbenzamide, commonly known as DEET, a widely used insect repellent. This compound features five deuterium atoms, making it highly valuable in environmental and toxicological research. The deuterium labeling enhances the accuracy of mass spectrometric analyses, allowing for precise tracking and quantification of the compound in environmental samples and biological systems. N,N-Diethylbenzamide-d5 is essential for studies on the environmental fate, metabolism, and efficacy of DEET, as well as in developing analytical methods for detecting this compound in various matrices. Its high purity and stability ensure reliable results in advanced research, particularly in understanding the behavior and safety of insect repellents
| CAS Number | NA |
| Synonyms | NSC 16060-d5; R 2-d5; R 2 (insect repellent)-d5; Rebemid-d5; Rebemide-d5; Benzoic Acid N,N-Diethylamide-d5; Benzoic Acid Diethylamide-d5; Benzoyldiethylamine-d5; ? |
| Molecular Formula | C₁₁H₁₀D₅NO |
| Purity | ≥95% |
| Storage | Store at -20°C |
| IUPAC Name | 2,3,4,5,6-pentadeuterio-N,N-diethylbenzamide |
| InChI | InChI=1S/C11H15NO/c1-3-12(4-2)11(13)10-8-6-5-7-9-10/h5-9H,3-4H2,1-2H3/i5D,6D,7D,8D,9D |
| InChIKey | JLNGEXDJAQASHD-CFEWMVNUSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])C(=O)N(CC)CC)[2H])[2H] |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |