For research use only. Not for therapeutic Use.
N,N-Diethyl-N’-1-naphthylethylenediamine oxalate (Cat No.: R051899) is a salt form of a substituted ethylenediamine, featuring a diethylamino group on one nitrogen and a 1-naphthyl group on the other. The compound is commonly used as a chromogenic reagent in colorimetric assays, particularly for detecting nitrite ions in water through the Griess reaction. The oxalate counterion enhances solubility and stability. Its ability to form intensely colored azo dyes upon diazotization makes it valuable in analytical chemistry, environmental monitoring, and water quality testing.
| CAS Number | 29473-53-8 |
| Synonyms | N1,N1-Diethyl-N2-1-naphthalenyl-1,2-ethanediamine Ethanedioate; β-Diethylaminoethyl-α-naphthylamine Oxalate; |
| Molecular Formula | C18H24N2O4 |
| Purity | ≥95% |
| Storage | 2-8°C |
| IUPAC Name | N/',N/'-diethyl-N-naphthalen-1-ylethane-1,2-diamine;oxalic acid |
| InChI | InChI=1S/C16H22N2.C2H2O4/c1-3-18(4-2)13-12-17-16-11-7-9-14-8-5-6-10-15(14)16;3-1(4)2(5)6/h5-11,17H,3-4,12-13H2,1-2H3;(H,3,4)(H,5,6) |
| InChIKey | MNUSPWMHIHYMKM-UHFFFAOYSA-N |
| SMILES | CCN(CC)CCNC1=CC=CC2=CC=CC=C21.C(=O)(C(=O)O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |