For research use only. Not for therapeutic Use.
N,N-Dibutyllactamide is a lactamide derivative commonly used as a solvent and intermediate in pharmaceutical and agrochemical research. With two butyl groups attached to the nitrogen atom, this compound offers enhanced solubility and stability, making it suitable for various chemical processes, including extractions and catalytic reactions. Its versatility supports the development of bioactive molecules and formulations, aiding in drug delivery and synthesis. N,N-Dibutyllactamide is also employed in materials science for its compatibility in creating specialized polymers and coatings.
CAS Number | 6288-16-0 |
Molecular Formula | C11H23NO2 |
Purity | ≥95% |
IUPAC Name | N,N-dibutyl-2-hydroxypropanamide |
InChI | InChI=1S/C11H23NO2/c1-4-6-8-12(9-7-5-2)11(14)10(3)13/h10,13H,4-9H2,1-3H3 |
InChIKey | ZXORIQDKFRZFHV-UHFFFAOYSA-N |
SMILES | CCCCN(CCCC)C(=O)C(C)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |