Home
>
Reference Standards> N,N'-Di(2-hydroxybenzyl)ethylenediamine-N,N'-diacetic acid monohydrochloride hydrate
For research use only. Not for therapeutic Use.
N,N’-Di(2-hydroxybenzyl)ethylenediamine-N,N’-diacetic acid monohydrochloride hydrate (often abbreviated as HBED) is a chelating agent, designed to form stable complexes with metal ions. It features hydroxyl and carboxyl groups that coordinate with metal ions, making it particularly useful in the sequestration of metal cations such as iron (Fe³⁺) or other transition metals. This chelating compound is used in research, medical applications (e.g., radiopharmaceuticals), and environmental chemistry to bind and control metal ions in a wide range of processes. Its ability to tightly bind metals makes it valuable for applications requiring metal ion removal or stabilization.
Catalog Number | M144091 |
CAS Number | 35369-53-0 |
Synonyms | HBED |
Molecular Formula | C20H24N2O6·HCl·XH2O |
Purity | ≥95% |
Appearance | off-white powder |
Storage | Store at 0-8°C |
IUPAC Name | 2-[2-[carboxymethyl-[(2-hydroxyphenyl)methyl]amino]ethyl-[(2-hydroxyphenyl)methyl]amino]acetic acid |
InChI | InChI=1S/C20H24N2O6/c23-17-7-3-1-5-15(17)11-21(13-19(25)26)9-10-22(14-20(27)28)12-16-6-2-4-8-18(16)24/h1-8,23-24H,9-14H2,(H,25,26)(H,27,28) |
InChIKey | GRUVVLWKPGIYEG-UHFFFAOYSA-N |
SMILES | C1=CC=C(C(=C1)CN(CCN(CC2=CC=CC=C2O)CC(=O)O)CC(=O)O)O |