For research use only. Not for therapeutic Use.
N,N-Bis(2-hydroxyethyl)-p-phenylenediamine sulfate(Cat No.:R072622)is a water-soluble, aromatic diamine compound commonly used as a hair dye intermediate in oxidative hair coloring formulations. It features a para-phenylenediamine core substituted with two 2-hydroxyethyl groups on the nitrogen atoms, enhancing solubility and reducing skin sensitization compared to unsubstituted analogs. The sulfate salt form improves stability and formulation compatibility. Upon oxidation, it forms colored complexes by coupling with other dye precursors. This compound is valued in cosmetic chemistry for its vibrant, long-lasting color results and is often regulated to ensure safe consumer use.
| CAS Number | 54381-16-7 |
| Molecular Formula | C10H18N2O6S |
| Purity | ≥95% |
| IUPAC Name | 2-[4-amino-N-(2-hydroxyethyl)anilino]ethanol;sulfuric acid |
| InChI | InChI=1S/C10H16N2O2.H2O4S/c11-9-1-3-10(4-2-9)12(5-7-13)6-8-14;1-5(2,3)4/h1-4,13-14H,5-8,11H2;(H2,1,2,3,4) |
| InChIKey | KMCFMEHSEWDYKG-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1N)N(CCO)CCO.OS(=O)(=O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |