For research use only. Not for therapeutic Use.
Nitroxinil(Cat No.:R055775)is a potent anthelmintic agent primarily used in veterinary medicine to control liver flukes (Fasciola hepatica), gastrointestinal nematodes, and certain ectoparasites in livestock. It acts by uncoupling oxidative phosphorylation in parasites, leading to energy depletion and death. Nitroxinil is particularly effective against fluke infestations, including those resistant to other anthelmintics. Administered via subcutaneous injection, it demonstrates high efficacy and rapid action. Its targeted activity and favorable safety profile make it a valuable tool in managing parasitic infections, supporting animal health and productivity in agricultural settings.
| CAS Number | 1689-89-0 |
| Synonyms | 4-Hydroxy-3-iodo-5-nitrobenzonitrile; 2-Iodo-4-cyano-6-nitrophenol; 3-Iodo-5-nitro-4-hydroxybenzonitrile; 3-Nitro-4-hydroxy-5-iodobenzonitrile; 3-Nitro-5-iodo-4-hydroxybenzonitrile; 4-Cyano-2-iodo-6-nitrophenol; M and B 10755; Nitroxynil; |
| Molecular Formula | C7H3IN2O3 |
| Purity | ≥95% |
| Target | Parasite |
| Storage | -20°C |
| IUPAC Name | 4-hydroxy-3-iodo-5-nitrobenzonitrile |
| InChI | InChI=1S/C7H3IN2O3/c8-5-1-4(3-9)2-6(7(5)11)10(12)13/h1-2,11H |
| InChIKey | SGKGVABHDAQAJO-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1[N+](=O)[O-])O)I)C#N |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |