For research use only. Not for therapeutic Use.
Nitroethane（Cat No.:R022074）is a high-purity organic compound widely used in industrial and chemical applications. As a solvent, it is valuable in coatings, adhesives, and cleaning solutions due to its excellent solubility properties. Nitroethane serves as an intermediate in the synthesis of pharmaceuticals, agrochemicals, and explosives. It is also utilized in the production of fuel additives and as a precursor for various organic syntheses. Its versatility and reactivity make it essential for advancing industrial processes and research in organic chemistry, contributing significantly to the development of innovative materials and products.
| Catalog Number | R022074 |
| CAS Number | 79-24-3 |
| Synonyms | NSC 8800 |
| Molecular Formula | C2H5NO2 |
| Purity | ≥95% |
| Storage | Store at -20C |
| IUPAC Name | 1-nitroethane |
| InChI | InChI=1S/C2H5NO2/c1-2-3(4)5/h2H2,1H3 |
| InChIKey | MCSAJNNLRCFZED-UHFFFAOYSA-N |
| SMILES | CC[N+](=O)[O-] |
