For research use only. Not for therapeutic Use.
NITD-2（Cat No.:I033343）is a selective and potent inhibitor of the dengue virus, developed as part of antiviral drug discovery efforts targeting flaviviruses. It acts by interfering with viral replication, although its exact molecular target remains under investigation. NITD-2 demonstrates strong antiviral activity in vitro against multiple dengue serotypes and shows favorable pharmacokinetics in preclinical models. Its development has contributed to understanding small-molecule inhibition of viral RNA replication. NITD-2 serves as a valuable research tool for exploring dengue virus biology and holds potential as a lead compound in antiviral therapeutic development.
| CAS Number | 1197896-79-9 |
| Synonyms | 2-[[3-(1-benzylpyrazol-4-yl)phenyl]sulfonylamino]benzoic acid |
| Molecular Formula | C23H19N3O4S |
| Purity | ≥95% |
| IUPAC Name | 2-[[3-(1-benzylpyrazol-4-yl)phenyl]sulfonylamino]benzoic acid |
| InChI | InChI=1S/C23H19N3O4S/c27-23(28)21-11-4-5-12-22(21)25-31(29,30)20-10-6-9-18(13-20)19-14-24-26(16-19)15-17-7-2-1-3-8-17/h1-14,16,25H,15H2,(H,27,28) |
| InChIKey | PHQOBFYGHBBCBV-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CN2C=C(C=N2)C3=CC(=CC=C3)S(=O)(=O)NC4=CC=CC=C4C(=O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
