For research use only. Not for therapeutic Use.
Nilutamide-d6(Cat No.:S000431) is a deuterated version of nilutamide, where six hydrogen atoms are replaced with deuterium. This adjustment enhances the compound’s stability, making it particularly useful for pharmacokinetic and metabolic studies. Nilutamide is an antiandrogen medication primarily used in the treatment of prostate cancer. It works by blocking androgen receptors and inhibiting the effects of testosterone, helping to slow the growth of cancer cells. The deuterated form, Nilutamide-d6, allows for more precise research into the drug’s behavior in the body, facilitating the understanding of its efficacy and potential side effects.
| CAS Number | 1189477-66-4 |
| Molecular Formula | C12H4D6F3N3O4 |
| Purity | ≥95% |
| IUPAC Name | 3-[4-nitro-3-(trifluoromethyl)phenyl]-5,5-bis(trideuteriomethyl)imidazolidine-2,4-dione |
| InChI | InChI=1S/C12H10F3N3O4/c1-11(2)9(19)17(10(20)16-11)6-3-4-8(18(21)22)7(5-6)12(13,14)15/h3-5H,1-2H3,(H,16,20)/i1D3,2D3 |
| InChIKey | XWXYUMMDTVBTOU-WFGJKAKNSA-N |
| SMILES | CC1(C(=O)N(C(=O)N1)C2=CC(=C(C=C2)[N+](=O)[O-])C(F)(F)F)C |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |