For research use only. Not for therapeutic Use.
Nifurpirinol（Cat No.:M055125）is a nitrofuran-class antimicrobial compound primarily used in veterinary and aquaculture applications to treat bacterial infections in fish. It exhibits broad-spectrum activity against Gram-negative and some Gram-positive bacteria by interfering with bacterial DNA and enzyme function through reactive intermediates generated from its nitro group. Nifurpirinol is effective in controlling diseases like columnaris and fin rot, making it a valuable agent in ornamental and food fish farming. Due to potential toxicity and regulatory concerns, its use is monitored, and it is often reserved for cases where other treatments are ineffective.
| CAS Number | 13411-16-0 |
| Synonyms | [6-[(E)-2-(5-nitrofuran-2-yl)ethenyl]pyridin-2-yl]methanol |
| Molecular Formula | C12H10N2O4 |
| Purity | ≥95% |
| IUPAC Name | [6-[(E)-2-(5-nitrofuran-2-yl)ethenyl]pyridin-2-yl]methanol |
| InChI | InChI=1S/C12H10N2O4/c15-8-10-3-1-2-9(13-10)4-5-11-6-7-12(18-11)14(16)17/h1-7,15H,8H2/b5-4+ |
| InChIKey | JQKHJQJVKRFMCO-SNAWJCMRSA-N |
| SMILES | C1=CC(=NC(=C1)/C=C/C2=CC=C(O2)[N+](=O)[O-])CO |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
